C13H20N3O2P — CID 118910669
(2S)-2-[[(2R)-2-(methylamino)-3-phosphanylpropanoyl]amino]-3-phenylpropanamide (PubChem CID 118910669) has the molecular formula C13H20N3O2P and a molecular weight of 281.30 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(methylamino)-3-phosphanylpropanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(2R)-2-(methylamino)-3-phosphanylpropanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 118910669 |
| Molecular Formula | C13H20N3O2P |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2S)-2-[[(2R)-2-(methylamino)-3-phosphanylpropanoyl]amino]-3-phenylpropanamide |
| SMILES | CN[C@@H](CP)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C13H20N3O2P/c1-15-11(8-19)13(18)16-10(12(14)17)7-9-5-3-2-4-6-9/h2-6,10-11,15H,7-8,19H2,1H3,(H2,14,17)(H,16,18)/t10-,11-/m0/s1 |
| InChIKey | ABILIFUNFXWMSB-QWRGUYRKSA-N |
| XLogP | -0.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|