C20H30N2O4S — CID 10453253
methyl (3S,4S)-6-methyl-4-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-3-sulfanylheptanoate (PubChem CID 10453253) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is methyl (3S,4S)-6-methyl-4-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-3-sulfanylheptanoate.
| Compound Name | methyl (3S,4S)-6-methyl-4-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-3-sulfanylheptanoate |
|---|---|
| PubChem CID | 10453253 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl (3S,4S)-6-methyl-4-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-3-sulfanylheptanoate |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)[C@@H](S)CC(=O)OC |
| InChI | InChI=1S/C20H30N2O4S/c1-13(2)10-15(17(27)12-18(23)26-4)19(24)22-16(20(25)21-3)11-14-8-6-5-7-9-14/h5-9,13,15-17,27H,10-12H2,1-4H3,(H,21,25)(H,22,24)/t15-,16+,17+/m1/s1 |
| InChIKey | QSPKCQZWRFZKMG-IKGGRYGDSA-N |
| XLogP | 1.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|