C21H30N2O5S — CID 10070888
methyl 3-acetylsulfanyl-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]-6-methylheptanoate (PubChem CID 10070888) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is methyl 3-acetylsulfanyl-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]-6-methylheptanoate.
| Compound Name | methyl 3-acetylsulfanyl-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]-6-methylheptanoate |
|---|---|
| PubChem CID | 10070888 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | methyl 3-acetylsulfanyl-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]-6-methylheptanoate |
| SMILES | COC(=O)CC(SC(C)=O)C(CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C21H30N2O5S/c1-13(2)10-16(18(29-14(3)24)12-19(25)28-4)21(27)23-17(20(22)26)11-15-8-6-5-7-9-15/h5-9,13,16-18H,10-12H2,1-4H3,(H2,22,26)(H,23,27)/t16?,17-,18?/m0/s1 |
| InChIKey | VYTXWJQMBKSANQ-ADKAHSJRSA-N |
| XLogP | 2.07 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|