C20H29NO4S — CID 10452323
methyl (2S)-2-[[(2R,3S)-3-acetylsulfanyl-2-benzyl-5-methylhexanoyl]amino]propanoate (PubChem CID 10452323) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,3S)-3-acetylsulfanyl-2-benzyl-5-methylhexanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2R,3S)-3-acetylsulfanyl-2-benzyl-5-methylhexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 10452323 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | methyl (2S)-2-[[(2R,3S)-3-acetylsulfanyl-2-benzyl-5-methylhexanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@@H](Cc1ccccc1)[C@H](CC(C)C)SC(C)=O |
| InChI | InChI=1S/C20H29NO4S/c1-13(2)11-18(26-15(4)22)17(12-16-9-7-6-8-10-16)19(23)21-14(3)20(24)25-5/h6-10,13-14,17-18H,11-12H2,1-5H3,(H,21,23)/t14-,17-,18-/m0/s1 |
| InChIKey | OQHCETXLVFYPHU-WBAXXEDZSA-N |
| XLogP | 3.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|