C23H30N2O2S — CID 73081829
4-methyl-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-[(2-sulfanylphenyl)methyl]pentanamide (PubChem CID 73081829) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 4-methyl-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-[(2-sulfanylphenyl)methyl]pentanamide.
| Compound Name | 4-methyl-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-[(2-sulfanylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 73081829 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-methyl-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-[(2-sulfanylphenyl)methyl]pentanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1S)CC(C)C |
| InChI | InChI=1S/C23H30N2O2S/c1-16(2)13-19(15-18-11-7-8-12-21(18)28)22(26)25-20(23(27)24-3)14-17-9-5-4-6-10-17/h4-12,16,19-20,28H,13-15H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | GHRJWXDBCCXKGI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|