C19H29N3O4 — CID 143203076
N'-hydroxy-N-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide (PubChem CID 143203076) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is N'-hydroxy-N-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide.
| Compound Name | N'-hydroxy-N-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 143203076 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N'-hydroxy-N-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(C)cc1)NC(=O)C(CC(=O)NO)CC(C)C |
| InChI | InChI=1S/C19H29N3O4/c1-12(2)9-15(11-17(23)22-26)18(24)21-16(19(25)20-4)10-14-7-5-13(3)6-8-14/h5-8,12,15-16,26H,9-11H2,1-4H3,(H,20,25)(H,21,24)(H,22,23)/t15?,16-/m0/s1 |
| InChIKey | RHDQAQUPQATMSI-LYKKTTPLSA-N |
| XLogP | 1.33 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|