C24H32N4O5 — CID 10599902
(2R)-N'-hydroxy-N-[(2S)-1-[2-(4-hydroxyphenyl)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]-2-(2-methylpropyl)butanediamide (PubChem CID 10599902) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[(2S)-1-[2-(4-hydroxyphenyl)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]-2-(2-methylpropyl)butanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[(2S)-1-[2-(4-hydroxyphenyl)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 10599902 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (2R)-N'-hydroxy-N-[(2S)-1-[2-(4-hydroxyphenyl)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]-2-(2-methylpropyl)butanediamide |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](Cc1ccncc1)C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C24H32N4O5/c1-16(2)13-19(15-22(30)28-33)23(31)27-21(14-18-7-10-25-11-8-18)24(32)26-12-9-17-3-5-20(29)6-4-17/h3-8,10-11,16,19,21,29,33H,9,12-15H2,1-2H3,(H,26,32)(H,27,31)(H,28,30)/t19-,21+/m1/s1 |
| InChIKey | LUZFASJCLDTWLF-CTNGQTDRSA-N |
| XLogP | 1.73 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|