C20H31N3O5 — CID 162387272
(2R)-N'-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-2-(octanoylamino)butanediamide (PubChem CID 162387272) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-2-(octanoylamino)butanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-2-(octanoylamino)butanediamide |
|---|---|
| PubChem CID | 162387272 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (2R)-N'-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-2-(octanoylamino)butanediamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(=O)NO)C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H31N3O5/c1-2-3-4-5-6-7-18(25)22-17(14-19(26)23-28)20(27)21-13-12-15-8-10-16(24)11-9-15/h8-11,17,24,28H,2-7,12-14H2,1H3,(H,21,27)(H,22,25)(H,23,26)/t17-/m1/s1 |
| InChIKey | IUVQSOMFGBFSLW-QGZVFWFLSA-N |
| XLogP | 1.79 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|