C21H33N3O4 — CID 162387401
(2R)-N-[2-(4-methoxyphenyl)ethyl]-2-(octanoylamino)butanediamide (PubChem CID 162387401) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is (2R)-N-[2-(4-methoxyphenyl)ethyl]-2-(octanoylamino)butanediamide.
| Compound Name | (2R)-N-[2-(4-methoxyphenyl)ethyl]-2-(octanoylamino)butanediamide |
|---|---|
| PubChem CID | 162387401 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (2R)-N-[2-(4-methoxyphenyl)ethyl]-2-(octanoylamino)butanediamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(=O)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H33N3O4/c1-3-4-5-6-7-8-20(26)24-18(15-19(22)25)21(27)23-14-13-16-9-11-17(28-2)12-10-16/h9-12,18H,3-8,13-15H2,1-2H3,(H2,22,25)(H,23,27)(H,24,26)/t18-/m1/s1 |
| InChIKey | NZFLCZFKSKSIFD-GOSISDBHSA-N |
| XLogP | 2.07 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|