C21H34N4O3 — CID 162387491
N-[(2R)-4-amino-4-imino-1-[2-(3-methoxyphenyl)ethylamino]-1-oxobutan-2-yl]octanamide (PubChem CID 162387491) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[(2R)-4-amino-4-imino-1-[2-(3-methoxyphenyl)ethylamino]-1-oxobutan-2-yl]octanamide.
| Compound Name | N-[(2R)-4-amino-4-imino-1-[2-(3-methoxyphenyl)ethylamino]-1-oxobutan-2-yl]octanamide |
|---|---|
| PubChem CID | 162387491 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | N-[(2R)-4-amino-4-imino-1-[2-(3-methoxyphenyl)ethylamino]-1-oxobutan-2-yl]octanamide |
| SMILES | [H]/N=C(\N)C[C@@H](NC(=O)CCCCCCC)C(=O)NCCc1cccc(OC)c1 |
| InChI | InChI=1S/C21H34N4O3/c1-3-4-5-6-7-11-20(26)25-18(15-19(22)23)21(27)24-13-12-16-9-8-10-17(14-16)28-2/h8-10,14,18H,3-7,11-13,15H2,1-2H3,(H3,22,23)(H,24,27)(H,25,26)/t18-/m1/s1 |
| InChIKey | OBKPZMSWHXKYDR-GOSISDBHSA-N |
| XLogP | 2.53 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|