C17H30N6O2 — CID 162387494
N-[(2R)-4-amino-1-[2-(1H-imidazol-5-yl)ethylamino]-4-imino-1-oxobutan-2-yl]octanamide (PubChem CID 162387494) has the molecular formula C17H30N6O2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[(2R)-4-amino-1-[2-(1H-imidazol-5-yl)ethylamino]-4-imino-1-oxobutan-2-yl]octanamide.
| Compound Name | N-[(2R)-4-amino-1-[2-(1H-imidazol-5-yl)ethylamino]-4-imino-1-oxobutan-2-yl]octanamide |
|---|---|
| PubChem CID | 162387494 |
| Molecular Formula | C17H30N6O2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | N-[(2R)-4-amino-1-[2-(1H-imidazol-5-yl)ethylamino]-4-imino-1-oxobutan-2-yl]octanamide |
| SMILES | [H]/N=C(\N)C[C@@H](NC(=O)CCCCCCC)C(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C17H30N6O2/c1-2-3-4-5-6-7-16(24)23-14(10-15(18)19)17(25)21-9-8-13-11-20-12-22-13/h11-12,14H,2-10H2,1H3,(H3,18,19)(H,20,22)(H,21,25)(H,23,24)/t14-/m1/s1 |
| InChIKey | PWRVPBIVNOPTKA-CQSZACIVSA-N |
| XLogP | 1.24 |
| TPSA | 136.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|