C27H34N4O4 — CID 11145249
(2R)-N-[(2S)-3-(4-cyanophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)-N'-phenylmethoxybutanediamide (PubChem CID 11145249) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is (2R)-N-[(2S)-3-(4-cyanophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)-N'-phenylmethoxybutanediamide.
| Compound Name | (2R)-N-[(2S)-3-(4-cyanophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)-N'-phenylmethoxybutanediamide |
|---|---|
| PubChem CID | 11145249 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (2R)-N-[(2S)-3-(4-cyanophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)-N'-phenylmethoxybutanediamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(C#N)cc1)NC(=O)[C@H](CC(C)C)C(C)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C27H34N4O4/c1-18(2)14-23(19(3)25(32)31-35-17-22-8-6-5-7-9-22)26(33)30-24(27(34)29-4)15-20-10-12-21(16-28)13-11-20/h5-13,18-19,23-24H,14-15,17H2,1-4H3,(H,29,34)(H,30,33)(H,31,32)/t19?,23-,24+/m1/s1 |
| InChIKey | GANZHUQWOSZRQP-XRVPCZGUSA-N |
| XLogP | 2.88 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|