C29H34Cl2N4O5 — CID 142075054
3,5-dichlorobenzamide;N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide (PubChem CID 142075054) has the molecular formula C29H34Cl2N4O5 and a molecular weight of 589.52 g/mol. Its IUPAC name is 3,5-dichlorobenzamide;N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide.
| Compound Name | 3,5-dichlorobenzamide;N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 142075054 |
| Molecular Formula | C29H34Cl2N4O5 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 3,5-dichlorobenzamide;N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)C(CC(=O)NO)Cc1ccc2ccccc2c1)C(C)(C)C.NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H29N3O4.C7H5Cl2NO/c1-22(2,3)19(21(28)23-4)24-20(27)17(13-18(26)25-29)12-14-9-10-15-7-5-6-8-16(15)11-14;8-5-1-4(7(10)11)2-6(9)3-5/h5-11,17,19,29H,12-13H2,1-4H3,(H,23,28)(H,24,27)(H,25,26);1-3H,(H2,10,11)/t17?,19-;/m1./s1 |
| InChIKey | PRGJKXWWSQDWPM-PZBUXUTESA-N |
| XLogP | 4.26 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|