C26H38N4O4 — CID 11798586
(2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(naphthalen-2-ylmethylamino)butanediamide (PubChem CID 11798586) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(naphthalen-2-ylmethylamino)butanediamide.
| Compound Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(naphthalen-2-ylmethylamino)butanediamide |
|---|---|
| PubChem CID | 11798586 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(naphthalen-2-ylmethylamino)butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](NCc1ccc2ccccc2c1)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C26H38N4O4/c1-16(2)13-20(23(31)29-22(25(33)27-6)26(3,4)5)21(24(32)30-34)28-15-17-11-12-18-9-7-8-10-19(18)14-17/h7-12,14,16,20-22,28,34H,13,15H2,1-6H3,(H,27,33)(H,29,31)(H,30,32)/t20-,21+,22-/m1/s1 |
| InChIKey | LYBBNJPLEUKQHO-BHIFYINESA-N |
| XLogP | 2.74 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|