C23H35N5O7S — CID 10673661
(2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]butanediamide (PubChem CID 10673661) has the molecular formula C23H35N5O7S and a molecular weight of 525.63 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]butanediamide.
| Compound Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]butanediamide |
|---|---|
| PubChem CID | 10673661 |
| Molecular Formula | C23H35N5O7S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](NS(=O)(=O)c1ccc2c(c1)CC(=O)N2)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C23H35N5O7S/c1-12(2)9-15(20(30)26-19(22(32)24-6)23(3,4)5)18(21(31)27-33)28-36(34,35)14-7-8-16-13(10-14)11-17(29)25-16/h7-8,10,12,15,18-19,28,33H,9,11H2,1-6H3,(H,24,32)(H,25,29)(H,26,30)(H,27,31)/t15-,18+,19-/m1/s1 |
| InChIKey | QKZJSMFYXFCVSP-AYOQOUSVSA-N |
| XLogP | 0.27 |
| TPSA | 182.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|