C19H32N4O6S2 — CID 10648271
(2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)butanediamide (PubChem CID 10648271) has the molecular formula C19H32N4O6S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)butanediamide.
| Compound Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)butanediamide |
|---|---|
| PubChem CID | 10648271 |
| Molecular Formula | C19H32N4O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](NS(=O)(=O)c1cccs1)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C19H32N4O6S2/c1-11(2)10-12(16(24)21-15(18(26)20-6)19(3,4)5)14(17(25)22-27)23-31(28,29)13-8-7-9-30-13/h7-9,11-12,14-15,23,27H,10H2,1-6H3,(H,20,26)(H,21,24)(H,22,25)/t12-,14+,15-/m1/s1 |
| InChIKey | VUYQZDVGRNXFIP-VHDGCEQUSA-N |
| XLogP | 0.84 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|