C27H40N4O5 — CID 59913833
(2R,3S)-3-[3-(dimethylamino)propoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide (PubChem CID 59913833) has the molecular formula C27H40N4O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is (2R,3S)-3-[3-(dimethylamino)propoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide.
| Compound Name | (2R,3S)-3-[3-(dimethylamino)propoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 59913833 |
| Molecular Formula | C27H40N4O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | (2R,3S)-3-[3-(dimethylamino)propoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](Cc1ccc2ccccc2c1)[C@H](OCCCN(C)C)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C27H40N4O5/c1-27(2,3)23(26(34)28-4)29-24(32)21(22(25(33)30-35)36-15-9-14-31(5)6)17-18-12-13-19-10-7-8-11-20(19)16-18/h7-8,10-13,16,21-23,35H,9,14-15,17H2,1-6H3,(H,28,34)(H,29,32)(H,30,33)/t21-,22+,23-/m1/s1 |
| InChIKey | UNPXZUUSBALDMW-XPWALMASSA-N |
| XLogP | 2.12 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|