C28H42N4O5 — CID 59913852
(2R,3S)-N-[(2S)-1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-propoxybutanediamide (PubChem CID 59913852) has the molecular formula C28H42N4O5 and a molecular weight of 514.67 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-propoxybutanediamide.
| Compound Name | (2R,3S)-N-[(2S)-1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-propoxybutanediamide |
|---|---|
| PubChem CID | 59913852 |
| Molecular Formula | C28H42N4O5 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | (2R,3S)-N-[(2S)-1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-propoxybutanediamide |
| SMILES | CCCO[C@H](C(=O)NO)[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](C(=O)NCCN(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H42N4O5/c1-7-16-37-23(26(34)31-36)22(18-19-12-13-20-10-8-9-11-21(20)17-19)25(33)30-24(28(2,3)4)27(35)29-14-15-32(5)6/h8-13,17,22-24,36H,7,14-16,18H2,1-6H3,(H,29,35)(H,30,33)(H,31,34)/t22-,23+,24-/m1/s1 |
| InChIKey | SBXMKLOLVXFITA-TZRRMPRUSA-N |
| XLogP | 2.51 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|