C28H39N3O5 — CID 23387737
3-cyclohexyloxy-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide (PubChem CID 23387737) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3-cyclohexyloxy-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide.
| Compound Name | 3-cyclohexyloxy-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 23387737 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 3-cyclohexyloxy-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)butanediamide |
| SMILES | CNC(=O)C(NC(=O)C(Cc1ccc2ccccc2c1)C(OC1CCCCC1)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C28H39N3O5/c1-28(2,3)24(27(34)29-4)30-25(32)22(17-18-14-15-19-10-8-9-11-20(19)16-18)23(26(33)31-35)36-21-12-6-5-7-13-21/h8-11,14-16,21-24,35H,5-7,12-13,17H2,1-4H3,(H,29,34)(H,30,32)(H,31,33) |
| InChIKey | AXAHURFPZZMTNT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|