C33H44N4O7 — CID 135731796
(2S,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-3-[(1-methyl-2-oxoquinolin-6-yl)methoxy]-2-(4-phenylmethoxybutyl)butanediamide (PubChem CID 135731796) has the molecular formula C33H44N4O7 and a molecular weight of 608.74 g/mol. Its IUPAC name is (2S,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-3-[(1-methyl-2-oxoquinolin-6-yl)methoxy]-2-(4-phenylmethoxybutyl)butanediamide.
| Compound Name | (2S,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-3-[(1-methyl-2-oxoquinolin-6-yl)methoxy]-2-(4-phenylmethoxybutyl)butanediamide |
|---|---|
| PubChem CID | 135731796 |
| Molecular Formula | C33H44N4O7 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | (2S,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-3-[(1-methyl-2-oxoquinolin-6-yl)methoxy]-2-(4-phenylmethoxybutyl)butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@@H](CCCCOCc1ccccc1)[C@H](OCc1ccc2c(ccc(=O)n2C)c1)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C33H44N4O7/c1-33(2,3)29(32(41)34-4)35-30(39)25(13-9-10-18-43-20-22-11-7-6-8-12-22)28(31(40)36-42)44-21-23-14-16-26-24(19-23)15-17-27(38)37(26)5/h6-8,11-12,14-17,19,25,28-29,42H,9-10,13,18,20-21H2,1-5H3,(H,34,41)(H,35,39)(H,36,40)/t25-,28-,29+/m0/s1 |
| InChIKey | VLIKEUSFLKKGIJ-OWPQXHQJSA-N |
| XLogP | 3.21 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|