C26H42N2O5 — CID 10322125
tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-phenylmethoxyheptanoate (PubChem CID 10322125) has the molecular formula C26H42N2O5 and a molecular weight of 462.63 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-phenylmethoxyheptanoate.
| Compound Name | tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 10322125 |
| Molecular Formula | C26H42N2O5 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-phenylmethoxyheptanoate |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CCCCOCc1ccccc1)CC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H42N2O5/c1-25(2,3)22(24(31)27-7)28-23(30)20(17-21(29)33-26(4,5)6)15-11-12-16-32-18-19-13-9-8-10-14-19/h8-10,13-14,20,22H,11-12,15-18H2,1-7H3,(H,27,31)(H,28,30)/t20-,22-/m1/s1 |
| InChIKey | KDKJQKQJRJHXCL-IFMALSPDSA-N |
| XLogP | 4.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|