C21H32N2O6 — CID 18395273
(3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-6-(4-methoxyphenoxy)hexanoic acid (PubChem CID 18395273) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-6-(4-methoxyphenoxy)hexanoic acid.
| Compound Name | (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-6-(4-methoxyphenoxy)hexanoic acid |
|---|---|
| PubChem CID | 18395273 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-6-(4-methoxyphenoxy)hexanoic acid |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CCCOc1ccc(OC)cc1)CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C21H32N2O6/c1-21(2,3)18(20(27)22-4)23-19(26)14(13-17(24)25)7-6-12-29-16-10-8-15(28-5)9-11-16/h8-11,14,18H,6-7,12-13H2,1-5H3,(H,22,27)(H,23,26)(H,24,25)/t14-,18-/m1/s1 |
| InChIKey | NUVPTOLODVBBLG-RDTXWAMCSA-N |
| XLogP | 2.22 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|