C12H16O6S — CID 82180471
2-[3-(4-methoxyphenoxy)propylsulfonyl]acetic acid (PubChem CID 82180471) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenoxy)propylsulfonyl]acetic acid.
| Compound Name | 2-[3-(4-methoxyphenoxy)propylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 82180471 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-[3-(4-methoxyphenoxy)propylsulfonyl]acetic acid |
| SMILES | COc1ccc(OCCCS(=O)(=O)CC(=O)O)cc1 |
| InChI | InChI=1S/C12H16O6S/c1-17-10-3-5-11(6-4-10)18-7-2-8-19(15,16)9-12(13)14/h3-6H,2,7-9H2,1H3,(H,13,14) |
| InChIKey | BTSIPRSLOGOSJR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|