C16H17O5S- — CID 101477557
3-[4-(4-methoxyphenyl)phenoxy]propane-1-sulfonate (PubChem CID 101477557) has the molecular formula C16H17O5S- and a molecular weight of 321.37 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)phenoxy]propane-1-sulfonate.
| Compound Name | 3-[4-(4-methoxyphenyl)phenoxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 101477557 |
| Molecular Formula | C16H17O5S- |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)phenoxy]propane-1-sulfonate |
| SMILES | COc1ccc(-c2ccc(OCCCS(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H18O5S/c1-20-15-7-3-13(4-8-15)14-5-9-16(10-6-14)21-11-2-12-22(17,18)19/h3-10H,2,11-12H2,1H3,(H,17,18,19)/p-1 |
| InChIKey | UVZPCYFNRWJBDN-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|