C25H27F3O6S2 — CID 159415805
4,4,4-trifluorobutane-1-sulfonate;tris(4-methoxyphenyl)sulfanium (PubChem CID 159415805) has the molecular formula C25H27F3O6S2 and a molecular weight of 544.61 g/mol. Its IUPAC name is 4,4,4-trifluorobutane-1-sulfonate;tris(4-methoxyphenyl)sulfanium.
| Compound Name | 4,4,4-trifluorobutane-1-sulfonate;tris(4-methoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 159415805 |
| Molecular Formula | C25H27F3O6S2 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 4,4,4-trifluorobutane-1-sulfonate;tris(4-methoxyphenyl)sulfanium |
| SMILES | COc1ccc([S+](c2ccc(OC)cc2)c2ccc(OC)cc2)cc1.O=S(=O)([O-])CCCC(F)(F)F |
| InChI | InChI=1S/C21H21O3S.C4H7F3O3S/c1-22-16-4-10-19(11-5-16)25(20-12-6-17(23-2)7-13-20)21-14-8-18(24-3)9-15-21;5-4(6,7)2-1-3-11(8,9)10/h4-15H,1-3H3;1-3H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | LPDKQCPZADRKOY-UHFFFAOYSA-M |
| XLogP | 5.68 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|