C19H22F3NO4S — CID 130367394
3,3,3-trifluoro-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide (PubChem CID 130367394) has the molecular formula C19H22F3NO4S and a molecular weight of 417.45 g/mol. Its IUPAC name is 3,3,3-trifluoro-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide.
| Compound Name | 3,3,3-trifluoro-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 130367394 |
| Molecular Formula | C19H22F3NO4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3,3,3-trifluoro-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3NO4S/c1-26-17-7-3-15(4-8-17)13-23(28(24,25)12-11-19(20,21)22)14-16-5-9-18(27-2)10-6-16/h3-10H,11-14H2,1-2H3 |
| InChIKey | NWSZDBVYSGZCEI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |