C24H28F3NO7S2 — CID 162473258
[(3R)-3-[(2S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl]propan-2-yl]cyclobuten-1-yl] trifluoromethanesulfonate (PubChem CID 162473258) has the molecular formula C24H28F3NO7S2 and a molecular weight of 563.62 g/mol. Its IUPAC name is [(3R)-3-[(2S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl]propan-2-yl]cyclobuten-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3R)-3-[(2S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl]propan-2-yl]cyclobuten-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162473258 |
| Molecular Formula | C24H28F3NO7S2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [(3R)-3-[(2S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl]propan-2-yl]cyclobuten-1-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)C[C@@H](C)[C@H]2C=C(OS(=O)(=O)C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C24H28F3NO7S2/c1-17(20-12-23(13-20)35-37(31,32)24(25,26)27)16-36(29,30)28(14-18-4-8-21(33-2)9-5-18)15-19-6-10-22(34-3)11-7-19/h4-12,17,20H,13-16H2,1-3H3/t17-,20+/m1/s1 |
| InChIKey | IGTTXNSXINWOSC-XLIONFOSSA-N |
| XLogP | 4.44 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|