C24H29F3N2O7S2 — CID 162473389
[3-[(1S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl-methylamino]ethyl]cyclobuten-1-yl] trifluoromethanesulfonate (PubChem CID 162473389) has the molecular formula C24H29F3N2O7S2 and a molecular weight of 578.63 g/mol. Its IUPAC name is [3-[(1S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl-methylamino]ethyl]cyclobuten-1-yl] trifluoromethanesulfonate.
| Compound Name | [3-[(1S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl-methylamino]ethyl]cyclobuten-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162473389 |
| Molecular Formula | C24H29F3N2O7S2 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [3-[(1S)-1-[bis[(4-methoxyphenyl)methyl]sulfamoyl-methylamino]ethyl]cyclobuten-1-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)N(C)[C@@H](C)C2C=C(OS(=O)(=O)C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C24H29F3N2O7S2/c1-17(20-13-23(14-20)36-37(30,31)24(25,26)27)28(2)38(32,33)29(15-18-5-9-21(34-3)10-6-18)16-19-7-11-22(35-4)12-8-19/h5-13,17,20H,14-16H2,1-4H3/t17-,20?/m0/s1 |
| InChIKey | RUNRJBSPNXKFDY-DIMJTDRSSA-N |
| XLogP | 4.04 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|