C8H9F3O4S — CID 150600515
8-oxabicyclo[3.2.1]oct-2-en-3-yl trifluoromethanesulfonate (PubChem CID 150600515) has the molecular formula C8H9F3O4S and a molecular weight of 258.22 g/mol. Its IUPAC name is 8-oxabicyclo[3.2.1]oct-2-en-3-yl trifluoromethanesulfonate.
| Compound Name | 8-oxabicyclo[3.2.1]oct-2-en-3-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 150600515 |
| Molecular Formula | C8H9F3O4S |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 8-oxabicyclo[3.2.1]oct-2-en-3-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CC2CCC(C1)O2)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O4S/c9-8(10,11)16(12,13)15-7-3-5-1-2-6(4-7)14-5/h3,5-6H,1-2,4H2 |
| InChIKey | IRTRZGRUUPUYOH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|