C9H11F3O3S — CID 129064247
[(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate (PubChem CID 129064247) has the molecular formula C9H11F3O3S and a molecular weight of 256.24 g/mol. Its IUPAC name is [(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 129064247 |
| Molecular Formula | C9H11F3O3S |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | [(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=C[C@H]2CCC[C@H]2C1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O3S/c10-9(11,12)16(13,14)15-8-4-6-2-1-3-7(6)5-8/h4,6-7H,1-3,5H2/t6-,7+/m1/s1 |
| InChIKey | DBTMAQZNFYCYJJ-RQJHMYQMSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|