C6H7F3O5S — CID 141375955
(2-methyl-4H-1,3-dioxin-5-yl) trifluoromethanesulfonate (PubChem CID 141375955) has the molecular formula C6H7F3O5S and a molecular weight of 248.18 g/mol. Its IUPAC name is (2-methyl-4H-1,3-dioxin-5-yl) trifluoromethanesulfonate.
| Compound Name | (2-methyl-4H-1,3-dioxin-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141375955 |
| Molecular Formula | C6H7F3O5S |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | (2-methyl-4H-1,3-dioxin-5-yl) trifluoromethanesulfonate |
| SMILES | CC1OC=C(OS(=O)(=O)C(F)(F)F)CO1 |
| InChI | InChI=1S/C6H7F3O5S/c1-4-12-2-5(3-13-4)14-15(10,11)6(7,8)9/h2,4H,3H2,1H3 |
| InChIKey | FINKTFWHUSVLRR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|