C9H13F3O3S — CID 11807395
(5-methyl(213C)cyclohepten-1-yl) trifluoromethanesulfonate (PubChem CID 11807395) has the molecular formula C9H13F3O3S and a molecular weight of 259.25 g/mol. Its IUPAC name is (5-methyl(213C)cyclohepten-1-yl) trifluoromethanesulfonate.
| Compound Name | (5-methyl(213C)cyclohepten-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11807395 |
| Molecular Formula | C9H13F3O3S |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (5-methyl(213C)cyclohepten-1-yl) trifluoromethanesulfonate |
| SMILES | CC1CC[13CH]=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3O3S/c1-7-3-2-4-8(6-5-7)15-16(13,14)9(10,11)12/h4,7H,2-3,5-6H2,1H3/i4+1 |
| InChIKey | JIDDXQSVISENNI-AZXPZELESA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|