C14H21F3O3S — CID 132566863
[(4aR,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 132566863) has the molecular formula C14H21F3O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is [(4aR,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 132566863 |
| Molecular Formula | C14H21F3O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(4aR,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)CCC[C@]2(C)C=C(OS(=O)(=O)C(F)(F)F)CC[C@H]12 |
| InChI | InChI=1S/C14H21F3O3S/c1-12(2)7-4-8-13(3)9-10(5-6-11(12)13)20-21(18,19)14(15,16)17/h9,11H,4-8H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | JZWFCPMEOSAXLE-DGCLKSJQSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|