About cyclopropen-1-yl trifluoromethanesulfonate
cyclopropen-1-yl trifluoromethanesulfonate (PubChem CID 89361921) has the molecular formula C4H3F3O3S
and a molecular weight of 188.13 g/mol. Its IUPAC name is cyclopropen-1-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | cyclopropen-1-yl trifluoromethanesulfonate |
| PubChem CID | 89361921 |
| Molecular Formula | C4H3F3O3S |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | cyclopropen-1-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CC1)C(F)(F)F |
| InChI | InChI=1S/C4H3F3O3S/c5-4(6,7)11(8,9)10-3-1-2-3/h1H,2H2 |
| InChIKey | JFDBHWWEKIVQHP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze cyclopropen-1-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropen-1-yl trifluoromethanesulfonate?
The IUPAC name of cyclopropen-1-yl trifluoromethanesulfonate (CID 89361921) is cyclopropen-1-yl trifluoromethanesulfonate.
What is the SMILES notation for cyclopropen-1-yl trifluoromethanesulfonate?
The canonical SMILES for cyclopropen-1-yl trifluoromethanesulfonate is O=S(=O)(OC1=CC1)C(F)(F)F.
What is the InChIKey of cyclopropen-1-yl trifluoromethanesulfonate?
The InChIKey is JFDBHWWEKIVQHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3F3O3S/c5-4(6,7)11(8,9)10-3-1-2-3/h1H,2H2.
What are the key properties of cyclopropen-1-yl trifluoromethanesulfonate?
cyclopropen-1-yl trifluoromethanesulfonate has a molecular weight of 188.13 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropen-1-yl trifluoromethanesulfonate is sourced from PubChem (CID 89361921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).