C8H9F6NO3S — CID 89078468
[1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 89078468) has the molecular formula C8H9F6NO3S and a molecular weight of 313.22 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89078468 |
| Molecular Formula | C8H9F6NO3S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | [1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CCN(CC(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C8H9F6NO3S/c9-7(10,11)5-15-3-1-6(2-4-15)18-19(16,17)8(12,13)14/h1H,2-5H2 |
| InChIKey | AWJXGLBXFYXILO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|