C10H15F3O3S — CID 142729649
[(5S)-4,4,5-trimethylcyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 142729649) has the molecular formula C10H15F3O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is [(5S)-4,4,5-trimethylcyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(5S)-4,4,5-trimethylcyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142729649 |
| Molecular Formula | C10H15F3O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | [(5S)-4,4,5-trimethylcyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | C[C@H]1CC(OS(=O)(=O)C(F)(F)F)=CCC1(C)C |
| InChI | InChI=1S/C10H15F3O3S/c1-7-6-8(4-5-9(7,2)3)16-17(14,15)10(11,12)13/h4,7H,5-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | JLSFVEANKTVDGH-ZETCQYMHSA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|