C11H15F3O5S — CID 129379274
ethyl (1S)-1-methyl-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate (PubChem CID 129379274) has the molecular formula C11H15F3O5S and a molecular weight of 316.30 g/mol. Its IUPAC name is ethyl (1S)-1-methyl-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S)-1-methyl-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 129379274 |
| Molecular Formula | C11H15F3O5S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | ethyl (1S)-1-methyl-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CC=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3O5S/c1-3-18-9(15)10(2)6-4-8(5-7-10)19-20(16,17)11(12,13)14/h4H,3,5-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | MATCXSXYXVEFMV-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|