C16H18F3NO6S — CID 130300261
ethyl 1-(pyridin-2-yloxymethyl)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate (PubChem CID 130300261) has the molecular formula C16H18F3NO6S and a molecular weight of 409.38 g/mol. Its IUPAC name is ethyl 1-(pyridin-2-yloxymethyl)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 1-(pyridin-2-yloxymethyl)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 130300261 |
| Molecular Formula | C16H18F3NO6S |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | ethyl 1-(pyridin-2-yloxymethyl)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(COc2ccccn2)CC=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H18F3NO6S/c1-2-24-14(21)15(11-25-13-5-3-4-10-20-13)8-6-12(7-9-15)26-27(22,23)16(17,18)19/h3-6,10H,2,7-9,11H2,1H3 |
| InChIKey | XEHIGHZZGPKVRU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|