C17H27F3O3S — CID 118679002
[4-methyl-4-(4-propylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 118679002) has the molecular formula C17H27F3O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is [4-methyl-4-(4-propylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [4-methyl-4-(4-propylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118679002 |
| Molecular Formula | C17H27F3O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [4-methyl-4-(4-propylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | CCCC1CCC(C2(C)CC=C(OS(=O)(=O)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H27F3O3S/c1-3-4-13-5-7-14(8-6-13)16(2)11-9-15(10-12-16)23-24(21,22)17(18,19)20/h9,13-14H,3-8,10-12H2,1-2H3 |
| InChIKey | FFRSVRDLBHFROG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|