C20H27F3O3S — CID 54274637
[(8S,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 54274637) has the molecular formula C20H27F3O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54274637 |
| Molecular Formula | C20H27F3O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC=C3C=C(OS(=O)(=O)C(F)(F)F)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H27F3O3S/c1-18-9-3-4-16(18)15-6-5-13-12-14(26-27(24,25)20(21,22)23)7-11-19(13,2)17(15)8-10-18/h5,12,15-17H,3-4,6-11H2,1-2H3/t15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | RMOIUCZNOJKPTK-VMXHOPILSA-N |
| XLogP | 5.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|