C23H36O2 — CID 130378582
(8S,9S,10S,13S,14S)-3-ethoxy-10-(ethoxymethyl)-13-methyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 130378582) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-3-ethoxy-10-(ethoxymethyl)-13-methyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10S,13S,14S)-3-ethoxy-10-(ethoxymethyl)-13-methyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 130378582 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (8S,9S,10S,13S,14S)-3-ethoxy-10-(ethoxymethyl)-13-methyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCOC[C@]12CCC(OCC)=CC1=CC[C@H]1[C@@H]3CCC[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C23H36O2/c1-4-24-16-23-14-10-18(25-5-2)15-17(23)8-9-19-20-7-6-12-22(20,3)13-11-21(19)23/h8,15,19-21H,4-7,9-14,16H2,1-3H3/t19-,20-,21-,22-,23+/m0/s1 |
| InChIKey | ISFOEVOEFMKRCX-XZCBWCRCSA-N |
| XLogP | 5.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |