C26H40O3 — CID 137428917
[(2S)-2-[(17R)-3-ethoxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl] acetate (PubChem CID 137428917) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is [(2S)-2-[(17R)-3-ethoxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl] acetate.
| Compound Name | [(2S)-2-[(17R)-3-ethoxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl] acetate |
|---|---|
| PubChem CID | 137428917 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | [(2S)-2-[(17R)-3-ethoxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl] acetate |
| SMILES | CCOC1=CC2=CCC3C(CCC4(C)C3CC[C@@H]4[C@H](C)COC(C)=O)C2(C)CC1 |
| InChI | InChI=1S/C26H40O3/c1-6-28-20-11-13-25(4)19(15-20)7-8-21-23-10-9-22(17(2)16-29-18(3)27)26(23,5)14-12-24(21)25/h7,15,17,21-24H,6,8-14,16H2,1-5H3/t17-,21?,22-,23?,24?,25?,26?/m1/s1 |
| InChIKey | LOSVZNPHUUPTTB-RCLSEAQJSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |