C24H35ClO3 — CID 57017842
[(2S)-2-[(8S,9S,10R,13S,14S,17R)-4-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl] acetate (PubChem CID 57017842) has the molecular formula C24H35ClO3 and a molecular weight of 406.99 g/mol. Its IUPAC name is [(2S)-2-[(8S,9S,10R,13S,14S,17R)-4-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl] acetate.
| Compound Name | [(2S)-2-[(8S,9S,10R,13S,14S,17R)-4-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl] acetate |
|---|---|
| PubChem CID | 57017842 |
| Molecular Formula | C24H35ClO3 |
| Molecular Weight | 406.99 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [(2S)-2-[(8S,9S,10R,13S,14S,17R)-4-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=C(Cl)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H35ClO3/c1-14(13-28-15(2)26)17-7-8-18-16-5-6-20-22(25)21(27)10-12-24(20,4)19(16)9-11-23(17,18)3/h14,16-19H,5-13H2,1-4H3/t14-,16+,17-,18+,19+,23-,24-/m1/s1 |
| InChIKey | OFZCRZRQQCEGFC-QKJBSRCHSA-N |
| XLogP | 5.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.99 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|