C21H31ClO2 — CID 177352790
4-chloro-17-ethoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 177352790) has the molecular formula C21H31ClO2 and a molecular weight of 350.93 g/mol. Its IUPAC name is 4-chloro-17-ethoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 4-chloro-17-ethoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 177352790 |
| Molecular Formula | C21H31ClO2 |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-chloro-17-ethoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCOC1CCC2C3CCC4=C(Cl)C(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C21H31ClO2/c1-4-24-18-8-7-14-13-5-6-16-19(22)17(23)10-12-20(16,2)15(13)9-11-21(14,18)3/h13-15,18H,4-12H2,1-3H3 |
| InChIKey | NUXVXHPXBIZFCE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|