C26H42O3 — CID 145403386
[(2S)-2-(6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propyl] acetate (PubChem CID 145403386) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is [(2S)-2-(6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propyl] acetate.
| Compound Name | [(2S)-2-(6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propyl] acetate |
|---|---|
| PubChem CID | 145403386 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | [(2S)-2-(6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propyl] acetate |
| SMILES | CCC1CC2C(CCC3(C)C2CCC3[C@H](C)COC(C)=O)C2(C)CCC(=O)CC12 |
| InChI | InChI=1S/C26H42O3/c1-6-18-13-20-22-8-7-21(16(2)15-29-17(3)27)25(22,4)12-10-23(20)26(5)11-9-19(28)14-24(18)26/h16,18,20-24H,6-15H2,1-5H3/t16-,18?,20?,21?,22?,23?,24?,25?,26?/m1/s1 |
| InChIKey | JNMOVKPUMCAJTM-RYGDVNPNSA-N |
| XLogP | 6.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |