C28H44O5 — CID 166647710
dimethyl 2-[2-[(6R)-6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl]propanedioate (PubChem CID 166647710) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is dimethyl 2-[2-[(6R)-6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[(6R)-6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 166647710 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | dimethyl 2-[2-[(6R)-6-ethyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl]propanedioate |
| SMILES | CC[C@@H]1CC2C3CCC(CCC(C(=O)OC)C(=O)OC)C3(C)CCC2C2(C)CCC(=O)CC12 |
| InChI | InChI=1S/C28H44O5/c1-6-17-15-21-22-10-8-18(7-9-20(25(30)32-4)26(31)33-5)27(22,2)14-12-23(21)28(3)13-11-19(29)16-24(17)28/h17-18,20-24H,6-16H2,1-5H3/t17-,18?,21?,22?,23?,24?,27?,28?/m1/s1 |
| InChIKey | ADVFYCDCQBMHAN-KWGYRZIVSA-N |
| XLogP | 5.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|