C26H42O2 — CID 142450674
methyl (E)-4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-2-enoate (PubChem CID 142450674) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is methyl (E)-4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-2-enoate |
|---|---|
| PubChem CID | 142450674 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | methyl (E)-4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-2-enoate |
| SMILES | CC[C@H]1CC2C3CCC(C/C=C/C(=O)OC)C3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C26H42O2/c1-5-18-17-20-22-13-12-19(9-8-11-24(27)28-4)25(22,2)16-14-23(20)26(3)15-7-6-10-21(18)26/h8,11,18-23H,5-7,9-10,12-17H2,1-4H3/b11-8+/t18-,19?,20?,21?,22?,23-,25?,26?/m0/s1 |
| InChIKey | XAUNOHAYVXCUCY-CYLVMGTGSA-N |
| XLogP | 6.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|