C25H45N — CID 154973667
3-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpropan-1-amine (PubChem CID 154973667) has the molecular formula C25H45N and a molecular weight of 359.64 g/mol. Its IUPAC name is 3-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 154973667 |
| Molecular Formula | C25H45N |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 359.36 |
| IUPAC Name | 3-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpropan-1-amine |
| SMILES | CC[C@H]1CC2C3CCC(CCCNC)C3(C)CCC2C2(C)CCCCC12 |
| InChI | InChI=1S/C25H45N/c1-5-18-17-20-22-12-11-19(9-8-16-26-4)24(22,2)15-13-23(20)25(3)14-7-6-10-21(18)25/h18-23,26H,5-17H2,1-4H3/t18-,19?,20?,21?,22?,23?,24?,25?/m0/s1 |
| InChIKey | QANAZDGOXJHTMF-ZGGOHCQISA-N |
| XLogP | 6.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|