C23H39NO — CID 167013770
(17R)-10,13-dimethyl-17-[3-(methylamino)propyl]-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one (PubChem CID 167013770) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is (17R)-10,13-dimethyl-17-[3-(methylamino)propyl]-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | (17R)-10,13-dimethyl-17-[3-(methylamino)propyl]-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 167013770 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | (17R)-10,13-dimethyl-17-[3-(methylamino)propyl]-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one |
| SMILES | CNCCC[C@H]1CCC2C3C(=O)CC4CCCCC4(C)C3CCC21C |
| InChI | InChI=1S/C23H39NO/c1-22-12-5-4-7-17(22)15-20(25)21-18-10-9-16(8-6-14-24-3)23(18,2)13-11-19(21)22/h16-19,21,24H,4-15H2,1-3H3/t16-,17?,18?,19?,21?,22?,23?/m0/s1 |
| InChIKey | LDMVSMJAWDWZOV-OCUBJICFSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|