C23H40O2 — CID 145403388
ethane;(17R)-17-(2-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one (PubChem CID 145403388) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is ethane;(17R)-17-(2-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | ethane;(17R)-17-(2-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 145403388 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | ethane;(17R)-17-(2-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one |
| SMILES | CC.CC12CCCCC1CC(=O)C1C2CCC2(C)C1CC[C@@H]2CCO |
| InChI | InChI=1S/C21H34O2.C2H6/c1-20-10-4-3-5-15(20)13-18(23)19-16-7-6-14(9-12-22)21(16,2)11-8-17(19)20;1-2/h14-17,19,22H,3-13H2,1-2H3;1-2H3/t14-,15?,16?,17?,19?,20?,21?;/m1./s1 |
| InChIKey | WVHOGVYOPITXJA-YPFDXNEGSA-N |
| XLogP | 5.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |